ChemNet > CAS > 77-79-2 Butadiene sulfone
77-79-2 Butadiene sulfone
| product Name |
Butadiene sulfone |
| Synonyms |
2,5-Dihydrothiophene-1,1-dioxide; 3-Sulfolene; Dihydrothiophene-1,1-dioxide; Butadiene sulphone; Cyclobutenesulfone |
| Molecular Formula |
C4H6O2S |
| Molecular Weight |
118.15 |
| InChI |
InChI=1/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
| CAS Registry Number |
77-79-2 |
| EINECS |
201-059-7 |
| Molecular Structure |
|
| Density |
1.314 |
| Melting point |
63-66℃ |
| Flash point |
112℃ |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
