ChemNet > CAS > 610-69-5 2-nitrophenyl acetate
610-69-5 2-nitrophenyl acetate
product Name |
2-nitrophenyl acetate |
Synonyms |
2-Nitrophenyl acetate; Acetic acid 2-nitrophenyl ester |
Molecular Formula |
C8H7NO4 |
Molecular Weight |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
CAS Registry Number |
610-69-5 |
EINECS |
210-233-1 |
Molecular Structure |
|
Density |
1.304g/cm3 |
Melting point |
39-41℃ |
Boiling point |
274.8°C at 760 mmHg |
Refractive index |
1.548 |
Flash point |
139.8°C |
Vapour Pressur |
0.00528mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|