CAS No: 20275-00-7;608-81-1;6336-64-7, Chemical Name: (1E)-2,3,4,5,6-pentahydroxyhexanal oxime (non-preferred name)
the physical and chemical property of 20275-00-7;608-81-1;6336-64-7, (1E)-2,3,4,5,6-pentahydroxyhexanal oxime (non-preferred name) is provided by ChemNet.com
ChemNet > CAS > 20275-00-7;608-81-1;6336-64-7 (1E)-2,3,4,5,6-pentahydroxyhexanal oxime (non-preferred name)
20275-00-7;608-81-1;6336-64-7 (1E)-2,3,4,5,6-pentahydroxyhexanal oxime (non-preferred name)
| product Name |
(1E)-2,3,4,5,6-pentahydroxyhexanal oxime (non-preferred name) |
| Synonyms |
D-Glucose oxime; D-Glucose, oxime; Glucose oxime; (2R,3R,4R,5S,6E)-6-(hydroxyimino)hexane-1,2,3,4,5-pentol (non-preferred name); (2R,3S,4R,5S,6E)-6-(hydroxyimino)hexane-1,2,3,4,5-pentol (non-preferred name) |
| Molecular Formula |
C6H13NO6 |
| Molecular Weight |
195.1705 |
| InChI |
InChI=1/C6H13NO6/c8-2-4(10)6(12)5(11)3(9)1-7-13/h1,3-6,8-13H,2H2/b7-1+/t3-,4+,5+,6-/m0/s1 |
| CAS Registry Number |
20275-00-7;608-81-1;6336-64-7 |
| Molecular Structure |
|
| Density |
1.66g/cm3 |
| Boiling point |
633.525°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
435.608°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
