ChemNet > CAS > 603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%)
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%)
product Name |
2,3,6-trinitrophenol moistened with water (H2O ~40%) |
Molecular Formula |
C6H3N3O7 |
Molecular Weight |
229.1039 |
InChI |
InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
CAS Registry Number |
603-10-1 |
Molecular Structure |
|
Density |
1.856g/cm3 |
Melting point |
119-120℃ |
Boiling point |
337.9°C at 760 mmHg |
Refractive index |
1.701 |
Flash point |
151.1°C |
Vapour Pressur |
5.2E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
|
|